C24H26N2O2S — CID 55917383
[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-[3-(4-methylphenyl)thiophen-2-yl]methanone (PubChem CID 55917383) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-[3-(4-methylphenyl)thiophen-2-yl]methanone.
| Compound Name | [4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-[3-(4-methylphenyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 55917383 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | [4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-[3-(4-methylphenyl)thiophen-2-yl]methanone |
| SMILES | COc1ccc(N2CCCN(C(=O)c3sccc3-c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-18-4-6-19(7-5-18)22-12-17-29-23(22)24(27)26-14-3-13-25(15-16-26)20-8-10-21(28-2)11-9-20/h4-12,17H,3,13-16H2,1-2H3 |
| InChIKey | FHFMOEWOAYEKCR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|