C18H21F2NO3S — CID 55921720
3-(difluoromethoxy)-4-methoxy-N-(3-methyl-1-thiophen-2-ylbutyl)benzamide (PubChem CID 55921720) has the molecular formula C18H21F2NO3S and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-(difluoromethoxy)-4-methoxy-N-(3-methyl-1-thiophen-2-ylbutyl)benzamide.
| Compound Name | 3-(difluoromethoxy)-4-methoxy-N-(3-methyl-1-thiophen-2-ylbutyl)benzamide |
|---|---|
| PubChem CID | 55921720 |
| Molecular Formula | C18H21F2NO3S |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-(difluoromethoxy)-4-methoxy-N-(3-methyl-1-thiophen-2-ylbutyl)benzamide |
| SMILES | COc1ccc(C(=O)NC(CC(C)C)c2cccs2)cc1OC(F)F |
| InChI | InChI=1S/C18H21F2NO3S/c1-11(2)9-13(16-5-4-8-25-16)21-17(22)12-6-7-14(23-3)15(10-12)24-18(19)20/h4-8,10-11,13,18H,9H2,1-3H3,(H,21,22) |
| InChIKey | ZHDVDCIBTRNBQO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |