C21H27NO5S — CID 55514711
methyl 3-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-3-thiophen-2-ylpropanoate (PubChem CID 55514711) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is methyl 3-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 55514711 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 3-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(OCCC(C)C)c(OC)c1)c1cccs1 |
| InChI | InChI=1S/C21H27NO5S/c1-14(2)9-10-27-17-8-7-15(12-18(17)25-3)21(24)22-16(13-20(23)26-4)19-6-5-11-28-19/h5-8,11-12,14,16H,9-10,13H2,1-4H3,(H,22,24) |
| InChIKey | WAWAQEKPRMTEGD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |