C19H21F2NO3S — CID 46452344
N-[cyclopentyl(thiophen-2-yl)methyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 46452344) has the molecular formula C19H21F2NO3S and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 46452344 |
| Molecular Formula | C19H21F2NO3S |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC(c2cccs2)C2CCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C19H21F2NO3S/c1-24-15-11-13(8-9-14(15)25-19(20)21)18(23)22-17(12-5-2-3-6-12)16-7-4-10-26-16/h4,7-12,17,19H,2-3,5-6H2,1H3,(H,22,23) |
| InChIKey | BNUBGCKTPITROG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |