C18H19FN2O6S — CID 55927521
(3-nitrophenyl)methyl (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 55927521) has the molecular formula C18H19FN2O6S and a molecular weight of 410.42 g/mol. Its IUPAC name is (3-nitrophenyl)methyl (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | (3-nitrophenyl)methyl (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55927521 |
| Molecular Formula | C18H19FN2O6S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (3-nitrophenyl)methyl (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19FN2O6S/c1-12(2)17(20-28(25,26)16-9-4-3-8-15(16)19)18(22)27-11-13-6-5-7-14(10-13)21(23)24/h3-10,12,17,20H,11H2,1-2H3/t17-/m0/s1 |
| InChIKey | OZRHNGNGLFMDJY-KRWDZBQOSA-N |
| XLogP | 2.78 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|