C18H21ClN2OS — CID 55928878
N-[1-(5-chlorothiophen-2-yl)ethyl]-2-(2-methylphenyl)pyrrolidine-1-carboxamide (PubChem CID 55928878) has the molecular formula C18H21ClN2OS and a molecular weight of 348.90 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-2-(2-methylphenyl)pyrrolidine-1-carboxamide.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2-(2-methylphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 55928878 |
| Molecular Formula | C18H21ClN2OS |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2-(2-methylphenyl)pyrrolidine-1-carboxamide |
| SMILES | Cc1ccccc1C1CCCN1C(=O)NC(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H21ClN2OS/c1-12-6-3-4-7-14(12)15-8-5-11-21(15)18(22)20-13(2)16-9-10-17(19)23-16/h3-4,6-7,9-10,13,15H,5,8,11H2,1-2H3,(H,20,22) |
| InChIKey | MVYOMVSIVNUIOB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |