C22H21FN2O5S — CID 55930463
2-(4-fluorophenyl)sulfonyl-N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]propanamide (PubChem CID 55930463) has the molecular formula C22H21FN2O5S and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]propanamide.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 55930463 |
| Molecular Formula | C22H21FN2O5S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]propanamide |
| SMILES | COc1cc(C)ccc1Oc1ccc(NC(=O)C(C)S(=O)(=O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C22H21FN2O5S/c1-14-4-10-19(20(12-14)29-3)30-21-11-7-17(13-24-21)25-22(26)15(2)31(27,28)18-8-5-16(23)6-9-18/h4-13,15H,1-3H3,(H,25,26) |
| InChIKey | MOSYJWJVDPWLBL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |