C21H17N3O6S — CID 56582665
N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 56582665) has the molecular formula C21H17N3O6S and a molecular weight of 439.45 g/mol. Its IUPAC name is N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56582665 |
| Molecular Formula | C21H17N3O6S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | COc1cc(C)ccc1Oc1ccc(NS(=O)(=O)c2ccc3c(c2)C(=O)NC3=O)cn1 |
| InChI | InChI=1S/C21H17N3O6S/c1-12-3-7-17(18(9-12)29-2)30-19-8-4-13(11-22-19)24-31(27,28)14-5-6-15-16(10-14)21(26)23-20(15)25/h3-11,24H,1-2H3,(H,23,25,26) |
| InChIKey | VDWKGMKAJFHIDV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|