C19H18N2O3S — CID 42878477
N-[6-(2,5-dimethylphenoxy)-3-pyridinyl]benzenesulfonamide (PubChem CID 42878477) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[6-(2,5-dimethylphenoxy)-3-pyridinyl]benzenesulfonamide.
| Compound Name | N-[6-(2,5-dimethylphenoxy)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42878477 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-[6-(2,5-dimethylphenoxy)-3-pyridinyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(Oc2ccc(NS(=O)(=O)c3ccccc3)cn2)c1 |
| InChI | InChI=1S/C19H18N2O3S/c1-14-8-9-15(2)18(12-14)24-19-11-10-16(13-20-19)21-25(22,23)17-6-4-3-5-7-17/h3-13,21H,1-2H3 |
| InChIKey | PTUUCAXBGSCQBT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |