C22H22FN3O5S — CID 55938605
methyl (2R)-2-[[4-fluoro-3-(prop-2-enylsulfamoyl)benzoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 55938605) has the molecular formula C22H22FN3O5S and a molecular weight of 459.50 g/mol. Its IUPAC name is methyl (2R)-2-[[4-fluoro-3-(prop-2-enylsulfamoyl)benzoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2R)-2-[[4-fluoro-3-(prop-2-enylsulfamoyl)benzoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 55938605 |
| Molecular Formula | C22H22FN3O5S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | methyl (2R)-2-[[4-fluoro-3-(prop-2-enylsulfamoyl)benzoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)OC)ccc1F |
| InChI | InChI=1S/C22H22FN3O5S/c1-3-10-25-32(29,30)20-12-14(8-9-17(20)23)21(27)26-19(22(28)31-2)11-15-13-24-18-7-5-4-6-16(15)18/h3-9,12-13,19,24-25H,1,10-11H2,2H3,(H,26,27)/t19-/m1/s1 |
| InChIKey | KEZXSVSBRHQUDM-LJQANCHMSA-N |
| XLogP | 2.29 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|