C18H18BrFN2O3 — CID 55939763
3-bromo-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-2-hydroxy-5-methylbenzamide (PubChem CID 55939763) has the molecular formula C18H18BrFN2O3 and a molecular weight of 409.26 g/mol. Its IUPAC name is 3-bromo-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-2-hydroxy-5-methylbenzamide.
| Compound Name | 3-bromo-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 55939763 |
| Molecular Formula | C18H18BrFN2O3 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 3-bromo-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1cc(Br)c(O)c(C(=O)NCCNC(=O)c2ccc(C)c(F)c2)c1 |
| InChI | InChI=1S/C18H18BrFN2O3/c1-10-7-13(16(23)14(19)8-10)18(25)22-6-5-21-17(24)12-4-3-11(2)15(20)9-12/h3-4,7-9,23H,5-6H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | OMDVRIFKEPHCCN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|