C25H36N4O4S — CID 55943069
(2S)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 55943069) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is (2S)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | (2S)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 55943069 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (2S)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)[C@@H](NS(=O)(=O)c3ccc(OC)cc3)C(C)C)c(C)c2)CC1 |
| InChI | InChI=1S/C25H36N4O4S/c1-6-28-13-15-29(16-14-28)20-7-12-23(19(4)17-20)26-25(30)24(18(2)3)27-34(31,32)22-10-8-21(33-5)9-11-22/h7-12,17-18,24,27H,6,13-16H2,1-5H3,(H,26,30)/t24-/m0/s1 |
| InChIKey | KLOTWCYPVGGOHQ-DEOSSOPVSA-N |
| XLogP | 3.09 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|