C26H27N3O4 — CID 55945677
2-(2-cyanophenoxy)-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-3-methylbutanamide (PubChem CID 55945677) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-3-methylbutanamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 55945677 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-3-methylbutanamide |
| SMILES | CCOc1ccc(Oc2cc(CNC(=O)C(Oc3ccccc3C#N)C(C)C)ccn2)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-4-31-21-9-11-22(12-10-21)32-24-15-19(13-14-28-24)17-29-26(30)25(18(2)3)33-23-8-6-5-7-20(23)16-27/h5-15,18,25H,4,17H2,1-3H3,(H,29,30) |
| InChIKey | FMONVKHSRPVSEM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |