C24H26N4O4S2 — CID 55946465
N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 55946465) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55946465 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | COc1cccc(CN2CCC(NC(=O)c3ccc(Sc4nc(C)cs4)c([N+](=O)[O-])c3)CC2)c1 |
| InChI | InChI=1S/C24H26N4O4S2/c1-16-15-33-24(25-16)34-22-7-6-18(13-21(22)28(30)31)23(29)26-19-8-10-27(11-9-19)14-17-4-3-5-20(12-17)32-2/h3-7,12-13,15,19H,8-11,14H2,1-2H3,(H,26,29) |
| InChIKey | UJAUAAXPXLQGHY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|