C21H28N4O3S2 — CID 55987779
N-[4-(2-methylpiperidin-1-yl)butyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 55987779) has the molecular formula C21H28N4O3S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[4-(2-methylpiperidin-1-yl)butyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-[4-(2-methylpiperidin-1-yl)butyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55987779 |
| Molecular Formula | C21H28N4O3S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[4-(2-methylpiperidin-1-yl)butyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cc1csc(Sc2ccc(C(=O)NCCCCN3CCCCC3C)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C21H28N4O3S2/c1-15-14-29-21(23-15)30-19-9-8-17(13-18(19)25(27)28)20(26)22-10-4-6-12-24-11-5-3-7-16(24)2/h8-9,13-14,16H,3-7,10-12H2,1-2H3,(H,22,26) |
| InChIKey | GNFZPFIXUZWVFN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|