C25H30ClN3O3 — CID 55947794
N-[1-[3-(4-chlorophenoxy)propyl-methylamino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-methylpropanamide (PubChem CID 55947794) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenoxy)propyl-methylamino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-methylpropanamide.
| Compound Name | N-[1-[3-(4-chlorophenoxy)propyl-methylamino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55947794 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[1-[3-(4-chlorophenoxy)propyl-methylamino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)N(C)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H30ClN3O3/c1-17(2)24(30)28-23(15-18-16-27-22-8-5-4-7-21(18)22)25(31)29(3)13-6-14-32-20-11-9-19(26)10-12-20/h4-5,7-12,16-17,23,27H,6,13-15H2,1-3H3,(H,28,30) |
| InChIKey | PYSRMCPFWRVSAT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|