C27H28F2N2O2 — CID 55949666
2-(2-benzylphenoxy)-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]acetamide (PubChem CID 55949666) has the molecular formula C27H28F2N2O2 and a molecular weight of 450.53 g/mol. Its IUPAC name is 2-(2-benzylphenoxy)-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]acetamide.
| Compound Name | 2-(2-benzylphenoxy)-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 55949666 |
| Molecular Formula | C27H28F2N2O2 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-(2-benzylphenoxy)-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]acetamide |
| SMILES | O=C(COc1ccccc1Cc1ccccc1)NC1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C27H28F2N2O2/c28-24-11-10-21(17-25(24)29)18-31-14-12-23(13-15-31)30-27(32)19-33-26-9-5-4-8-22(26)16-20-6-2-1-3-7-20/h1-11,17,23H,12-16,18-19H2,(H,30,32) |
| InChIKey | MOVFGJVVFFKCDW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |