C25H31N3O5S — CID 55952714
4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[3-(cyclohexylamino)-3-oxopropyl]benzamide (PubChem CID 55952714) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[3-(cyclohexylamino)-3-oxopropyl]benzamide.
| Compound Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[3-(cyclohexylamino)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 55952714 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[3-(cyclohexylamino)-3-oxopropyl]benzamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCc2ccc(C(=O)NCCC(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H31N3O5S/c1-18(29)20-11-13-23(14-12-20)34(32,33)27-17-19-7-9-21(10-8-19)25(31)26-16-15-24(30)28-22-5-3-2-4-6-22/h7-14,22,27H,2-6,15-17H2,1H3,(H,26,31)(H,28,30) |
| InChIKey | BTARBIPVLSETMU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |