C5H7N2O2S+ — CID 559541
2-(2-amino-1,3-thiazol-3-ium-3-yl)acetic acid (PubChem CID 559541) has the molecular formula C5H7N2O2S+ and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetic acid |
|---|---|
| PubChem CID | 559541 |
| Molecular Formula | C5H7N2O2S+ |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetic acid |
| SMILES | Nc1scc[n+]1CC(=O)O |
| InChI | InChI=1S/C5H6N2O2S/c6-5-7(1-2-10-5)3-4(8)9/h1-2,6H,3H2,(H,8,9)/p+1 |
| InChIKey | UGZFQKKKGOPZMG-UHFFFAOYSA-O |
| XLogP | -0.30 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|