C5H4N2O3S — CID 23038953
2-oxo-2-(1,3-thiazol-2-ylamino)acetic acid (PubChem CID 23038953) has the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. Its IUPAC name is 2-oxo-2-(1,3-thiazol-2-ylamino)acetic acid.
| Compound Name | 2-oxo-2-(1,3-thiazol-2-ylamino)acetic acid |
|---|---|
| PubChem CID | 23038953 |
| Molecular Formula | C5H4N2O3S |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 2-oxo-2-(1,3-thiazol-2-ylamino)acetic acid |
| SMILES | O=C(O)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C5H4N2O3S/c8-3(4(9)10)7-5-6-1-2-11-5/h1-2H,(H,9,10)(H,6,7,8) |
| InChIKey | OPYBRLFGZHVSOI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|