C26H26FN3O3 — CID 55959409
N-[2-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-2-oxoethyl]-2-naphthalen-1-ylacetamide (PubChem CID 55959409) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is N-[2-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-2-oxoethyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[2-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-2-oxoethyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 55959409 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-[2-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-2-oxoethyl]-2-naphthalen-1-ylacetamide |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)CNC(=O)Cc3cccc4ccccc34)CC2)cc1F |
| InChI | InChI=1S/C26H26FN3O3/c1-18-9-10-21(15-23(18)27)26(33)30-13-11-29(12-14-30)25(32)17-28-24(31)16-20-7-4-6-19-5-2-3-8-22(19)20/h2-10,15H,11-14,16-17H2,1H3,(H,28,31) |
| InChIKey | UEEQUKLMJMYZSW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |