C22H24N4O2 — CID 55959478
1-ethyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]indole-2-carboxamide (PubChem CID 55959478) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-ethyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]indole-2-carboxamide.
| Compound Name | 1-ethyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 55959478 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-ethyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NCc2ccc(N3CCNC(=O)C3)cc2)cc2ccccc21 |
| InChI | InChI=1S/C22H24N4O2/c1-2-26-19-6-4-3-5-17(19)13-20(26)22(28)24-14-16-7-9-18(10-8-16)25-12-11-23-21(27)15-25/h3-10,13H,2,11-12,14-15H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | UKOYVBFIMYKHDF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|