C20H22FN3O4 — CID 55960270
N-(2-amino-2-oxoethyl)-4-[[4-(3-fluorophenoxy)butanoylamino]methyl]benzamide (PubChem CID 55960270) has the molecular formula C20H22FN3O4 and a molecular weight of 387.41 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[4-(3-fluorophenoxy)butanoylamino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[4-(3-fluorophenoxy)butanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 55960270 |
| Molecular Formula | C20H22FN3O4 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[4-(3-fluorophenoxy)butanoylamino]methyl]benzamide |
| SMILES | NC(=O)CNC(=O)c1ccc(CNC(=O)CCCOc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H22FN3O4/c21-16-3-1-4-17(11-16)28-10-2-5-19(26)23-12-14-6-8-15(9-7-14)20(27)24-13-18(22)25/h1,3-4,6-9,11H,2,5,10,12-13H2,(H2,22,25)(H,23,26)(H,24,27) |
| InChIKey | DVRFPBFTMPPQTM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|