C20H18N2O2S — CID 55960734
N-[3-(3-cyanopropoxy)phenyl]-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 55960734) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)phenyl]-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(3-cyanopropoxy)phenyl]-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55960734 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[3-(3-cyanopropoxy)phenyl]-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(OCCCC#N)c2)sc2ccccc12 |
| InChI | InChI=1S/C20H18N2O2S/c1-14-17-9-2-3-10-18(17)25-19(14)20(23)22-15-7-6-8-16(13-15)24-12-5-4-11-21/h2-3,6-10,13H,4-5,12H2,1H3,(H,22,23) |
| InChIKey | FBIAPJHGOMTPRC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|