C19H16ClNO4S — CID 39269573
ethyl 2-[3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]phenoxy]acetate (PubChem CID 39269573) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is ethyl 2-[3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 39269573 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | ethyl 2-[3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C19H16ClNO4S/c1-2-24-16(22)11-25-13-7-5-6-12(10-13)21-19(23)18-17(20)14-8-3-4-9-15(14)26-18/h3-10H,2,11H2,1H3,(H,21,23) |
| InChIKey | PHABABWLFYKBHZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |