C18H18N2O2S — CID 87026604
N-[3-(3-cyanopropoxy)phenyl]-4-methylsulfanylbenzamide (PubChem CID 87026604) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)phenyl]-4-methylsulfanylbenzamide.
| Compound Name | N-[3-(3-cyanopropoxy)phenyl]-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 87026604 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[3-(3-cyanopropoxy)phenyl]-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)Nc2cccc(OCCCC#N)c2)cc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-23-17-9-7-14(8-10-17)18(21)20-15-5-4-6-16(13-15)22-12-3-2-11-19/h4-10,13H,2-3,12H2,1H3,(H,20,21) |
| InChIKey | RZBRIXCNTGTWRS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|