C20H24N4O2S — CID 87026616
N-[3-(3-cyanopropoxy)phenyl]-4-methyl-6-methylsulfanyl-2-propan-2-ylpyrimidine-5-carboxamide (PubChem CID 87026616) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)phenyl]-4-methyl-6-methylsulfanyl-2-propan-2-ylpyrimidine-5-carboxamide.
| Compound Name | N-[3-(3-cyanopropoxy)phenyl]-4-methyl-6-methylsulfanyl-2-propan-2-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87026616 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[3-(3-cyanopropoxy)phenyl]-4-methyl-6-methylsulfanyl-2-propan-2-ylpyrimidine-5-carboxamide |
| SMILES | CSc1nc(C(C)C)nc(C)c1C(=O)Nc1cccc(OCCCC#N)c1 |
| InChI | InChI=1S/C20H24N4O2S/c1-13(2)18-22-14(3)17(20(24-18)27-4)19(25)23-15-8-7-9-16(12-15)26-11-6-5-10-21/h7-9,12-13H,5-6,11H2,1-4H3,(H,23,25) |
| InChIKey | MOVGRGVZAAQSSU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|