C23H26FN3O2 — CID 55961180
N-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]-4-(2-fluorophenoxy)butanamide (PubChem CID 55961180) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]-4-(2-fluorophenoxy)butanamide.
| Compound Name | N-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]-4-(2-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 55961180 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]-4-(2-fluorophenoxy)butanamide |
| SMILES | Cc1cc(C)n(Cc2cccc(CNC(=O)CCCOc3ccccc3F)c2)n1 |
| InChI | InChI=1S/C23H26FN3O2/c1-17-13-18(2)27(26-17)16-20-8-5-7-19(14-20)15-25-23(28)11-6-12-29-22-10-4-3-9-21(22)24/h3-5,7-10,13-14H,6,11-12,15-16H2,1-2H3,(H,25,28) |
| InChIKey | VINCSRXTWMEORF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|