C18H24ClN3O4S2 — CID 55961282
2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N-[3-[ethylsulfonyl(methyl)amino]propyl]acetamide (PubChem CID 55961282) has the molecular formula C18H24ClN3O4S2 and a molecular weight of 445.99 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N-[3-[ethylsulfonyl(methyl)amino]propyl]acetamide.
| Compound Name | 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N-[3-[ethylsulfonyl(methyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 55961282 |
| Molecular Formula | C18H24ClN3O4S2 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N-[3-[ethylsulfonyl(methyl)amino]propyl]acetamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)Cc1csc(COc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H24ClN3O4S2/c1-3-28(24,25)22(2)10-4-9-20-17(23)11-15-13-27-18(21-15)12-26-16-7-5-14(19)6-8-16/h5-8,13H,3-4,9-12H2,1-2H3,(H,20,23) |
| InChIKey | URBDFJGODAEQHI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|