C23H23ClN4O2S — CID 55451065
2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]acetamide (PubChem CID 55451065) has the molecular formula C23H23ClN4O2S and a molecular weight of 454.98 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]acetamide.
| Compound Name | 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 55451065 |
| Molecular Formula | C23H23ClN4O2S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]acetamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)Cc1csc(COc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C23H23ClN4O2S/c1-16-26-20-5-2-3-6-21(20)28(16)12-4-11-25-22(29)13-18-15-31-23(27-18)14-30-19-9-7-17(24)8-10-19/h2-3,5-10,15H,4,11-14H2,1H3,(H,25,29) |
| InChIKey | XEFUPCIEVIWEDF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|