C18H21BrN4O3S2 — CID 55962042
(E)-3-(5-bromothiophen-2-yl)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]prop-2-enamide (PubChem CID 55962042) has the molecular formula C18H21BrN4O3S2 and a molecular weight of 485.43 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55962042 |
| Molecular Formula | C18H21BrN4O3S2 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)NCCS(=O)(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H21BrN4O3S2/c19-16-6-4-15(27-16)5-7-18(24)21-9-14-28(25,26)23-12-10-22(11-13-23)17-3-1-2-8-20-17/h1-8H,9-14H2,(H,21,24)/b7-5+ |
| InChIKey | IZXIGFSDPZLARZ-FNORWQNLSA-N |
| XLogP | 2.19 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|