C23H33N3O — CID 55964578
N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-1-prop-2-ynylpiperidine-2-carboxamide (PubChem CID 55964578) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-1-prop-2-ynylpiperidine-2-carboxamide.
| Compound Name | N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-1-prop-2-ynylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 55964578 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-1-prop-2-ynylpiperidine-2-carboxamide |
| SMILES | C#CCN1CCCCC1C(=O)NCc1ccccc1CN1CCCC(C)C1 |
| InChI | InChI=1S/C23H33N3O/c1-3-13-26-15-7-6-12-22(26)23(27)24-16-20-10-4-5-11-21(20)18-25-14-8-9-19(2)17-25/h1,4-5,10-11,19,22H,6-9,12-18H2,2H3,(H,24,27) |
| InChIKey | HJLUJBDWWMOLBG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|