C21H35N3O5S2 — CID 55966262
N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-1-propylsulfonylpiperidine-2-carboxamide (PubChem CID 55966262) has the molecular formula C21H35N3O5S2 and a molecular weight of 473.66 g/mol. Its IUPAC name is N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-1-propylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-1-propylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 55966262 |
| Molecular Formula | C21H35N3O5S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-1-propylsulfonylpiperidine-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCCC1C(=O)NC(C)c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C21H35N3O5S2/c1-5-16-30(26,27)24-15-9-8-10-20(24)21(25)22-17(4)18-11-13-19(14-12-18)31(28,29)23(6-2)7-3/h11-14,17,20H,5-10,15-16H2,1-4H3,(H,22,25) |
| InChIKey | CUFGEPBAFZPJCL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |