C18H18FN5O3 — CID 55966723
2-amino-5-fluoro-N-[3-(2-methylbenzimidazol-1-yl)propyl]-3-nitrobenzamide (PubChem CID 55966723) has the molecular formula C18H18FN5O3 and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-amino-5-fluoro-N-[3-(2-methylbenzimidazol-1-yl)propyl]-3-nitrobenzamide.
| Compound Name | 2-amino-5-fluoro-N-[3-(2-methylbenzimidazol-1-yl)propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55966723 |
| Molecular Formula | C18H18FN5O3 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-amino-5-fluoro-N-[3-(2-methylbenzimidazol-1-yl)propyl]-3-nitrobenzamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)c1cc(F)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C18H18FN5O3/c1-11-22-14-5-2-3-6-15(14)23(11)8-4-7-21-18(25)13-9-12(19)10-16(17(13)20)24(26)27/h2-3,5-6,9-10H,4,7-8,20H2,1H3,(H,21,25) |
| InChIKey | KJIWGRJQUDVINT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|