C24H29N5O4S — CID 55967772
N-[3-(3-ethoxypropylcarbamoyl)phenyl]-4-methyl-2-(2,5,6-trimethyl-3-oxopyridazin-4-yl)-1,3-thiazole-5-carboxamide (PubChem CID 55967772) has the molecular formula C24H29N5O4S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[3-(3-ethoxypropylcarbamoyl)phenyl]-4-methyl-2-(2,5,6-trimethyl-3-oxopyridazin-4-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-(3-ethoxypropylcarbamoyl)phenyl]-4-methyl-2-(2,5,6-trimethyl-3-oxopyridazin-4-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55967772 |
| Molecular Formula | C24H29N5O4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-[3-(3-ethoxypropylcarbamoyl)phenyl]-4-methyl-2-(2,5,6-trimethyl-3-oxopyridazin-4-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)c2sc(-c3c(C)c(C)nn(C)c3=O)nc2C)c1 |
| InChI | InChI=1S/C24H29N5O4S/c1-6-33-12-8-11-25-21(30)17-9-7-10-18(13-17)27-22(31)20-16(4)26-23(34-20)19-14(2)15(3)28-29(5)24(19)32/h7,9-10,13H,6,8,11-12H2,1-5H3,(H,25,30)(H,27,31) |
| InChIKey | MHVAPDXMEHGSGQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|