C23H28N2O6S — CID 55969031
2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 55969031) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 55969031 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccccc1CN(CC1CCCO1)C(=O)CSCc1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28N2O6S/c1-29-21-8-4-3-6-18(21)13-24(14-19-7-5-11-31-19)23(26)16-32-15-17-9-10-22(30-2)20(12-17)25(27)28/h3-4,6,8-10,12,19H,5,7,11,13-16H2,1-2H3 |
| InChIKey | YZLDJAQVBBPUJG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|