C24H30N4O5S — CID 55969865
2-methoxy-N-[3-methyl-1-[3-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylanilino]-1-oxobutan-2-yl]benzamide (PubChem CID 55969865) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is 2-methoxy-N-[3-methyl-1-[3-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylanilino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-methoxy-N-[3-methyl-1-[3-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylanilino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55969865 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-methoxy-N-[3-methyl-1-[3-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylanilino]-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccccc1C(=O)NC(C(=O)Nc1cccc(S(=O)(=O)/N=C2/CCCN2C)c1)C(C)C |
| InChI | InChI=1S/C24H30N4O5S/c1-16(2)22(26-23(29)19-11-5-6-12-20(19)33-4)24(30)25-17-9-7-10-18(15-17)34(31,32)27-21-13-8-14-28(21)3/h5-7,9-12,15-16,22H,8,13-14H2,1-4H3,(H,25,30)(H,26,29)/b27-21- |
| InChIKey | RBYPLSMAUWLXCN-MEFGMAGPSA-N |
| XLogP | 2.90 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|