C23H24N4O5S — CID 55972739
[4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 4-(pyridin-4-ylsulfamoyl)benzoate (PubChem CID 55972739) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 4-(pyridin-4-ylsulfamoyl)benzoate.
| Compound Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 4-(pyridin-4-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55972739 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 4-(pyridin-4-ylsulfamoyl)benzoate |
| SMILES | CC(C)NC(=O)N(C)c1ccc(OC(=O)c2ccc(S(=O)(=O)Nc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N4O5S/c1-16(2)25-23(29)27(3)19-6-8-20(9-7-19)32-22(28)17-4-10-21(11-5-17)33(30,31)26-18-12-14-24-15-13-18/h4-16H,1-3H3,(H,24,26)(H,25,29) |
| InChIKey | HJQLDFFAGLOZBZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|