C20H24ClN3O5S — CID 55751084
[4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 4-chloro-3-(dimethylsulfamoyl)benzoate (PubChem CID 55751084) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 4-chloro-3-(dimethylsulfamoyl)benzoate.
| Compound Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 4-chloro-3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55751084 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 4-chloro-3-(dimethylsulfamoyl)benzoate |
| SMILES | CC(C)NC(=O)N(C)c1ccc(OC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C20H24ClN3O5S/c1-13(2)22-20(26)24(5)15-7-9-16(10-8-15)29-19(25)14-6-11-17(21)18(12-14)30(27,28)23(3)4/h6-13H,1-5H3,(H,22,26) |
| InChIKey | SZWGRKJIZIGZLX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|