C20H28FN3O4S — CID 55974982
1-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 55974982) has the molecular formula C20H28FN3O4S and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55974982 |
| Molecular Formula | C20H28FN3O4S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(C(=O)CSCC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H28FN3O4S/c1-28-12-2-9-22-20(27)15-7-10-24(11-8-15)19(26)14-29-13-18(25)23-17-5-3-16(21)4-6-17/h3-6,15H,2,7-14H2,1H3,(H,22,27)(H,23,25) |
| InChIKey | QTHBJVTZLGYDIR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|