C19H20F2N4O3 — CID 55978653
2-fluoro-N-[2-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]ethyl]benzamide (PubChem CID 55978653) has the molecular formula C19H20F2N4O3 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-fluoro-N-[2-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55978653 |
| Molecular Formula | C19H20F2N4O3 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-fluoro-N-[2-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)NCc1ccc(F)cc1)NCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C19H20F2N4O3/c20-14-7-5-13(6-8-14)11-24-19(28)25-12-17(26)22-9-10-23-18(27)15-3-1-2-4-16(15)21/h1-8H,9-12H2,(H,22,26)(H,23,27)(H2,24,25,28) |
| InChIKey | GVEGIRNODVEPRN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|