C13H11N5O3S — CID 55978903
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-nitro-1H-indole-2-carboxamide (PubChem CID 55978903) has the molecular formula C13H11N5O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-nitro-1H-indole-2-carboxamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55978903 |
| Molecular Formula | C13H11N5O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-nitro-1H-indole-2-carboxamide |
| SMILES | CCc1nnc(NC(=O)c2cc3cccc([N+](=O)[O-])c3[nH]2)s1 |
| InChI | InChI=1S/C13H11N5O3S/c1-2-10-16-17-13(22-10)15-12(19)8-6-7-4-3-5-9(18(20)21)11(7)14-8/h3-6,14H,2H2,1H3,(H,15,17,19) |
| InChIKey | GGJNBUIDWLEJSH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|