C20H17N5OS — CID 55979153
N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 55979153) has the molecular formula C20H17N5OS and a molecular weight of 375.46 g/mol. Its IUPAC name is N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 55979153 |
| Molecular Formula | C20H17N5OS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccccn2)s1)c1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C20H17N5OS/c26-18(23-20-25-24-19(27-20)16-10-3-4-11-21-16)14-8-5-7-13-12-6-1-2-9-15(12)22-17(13)14/h3-5,7-8,10-11,22H,1-2,6,9H2,(H,23,25,26) |
| InChIKey | TUOLVKBVINUVLM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|