C21H20FN3O6S2 — CID 55979786
N-(3-fluoro-5-sulfamoylphenyl)-3-[(4-methoxyphenyl)sulfamoyl]-4-methylbenzamide (PubChem CID 55979786) has the molecular formula C21H20FN3O6S2 and a molecular weight of 493.54 g/mol. Its IUPAC name is N-(3-fluoro-5-sulfamoylphenyl)-3-[(4-methoxyphenyl)sulfamoyl]-4-methylbenzamide.
| Compound Name | N-(3-fluoro-5-sulfamoylphenyl)-3-[(4-methoxyphenyl)sulfamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55979786 |
| Molecular Formula | C21H20FN3O6S2 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | N-(3-fluoro-5-sulfamoylphenyl)-3-[(4-methoxyphenyl)sulfamoyl]-4-methylbenzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C(=O)Nc3cc(F)cc(S(N)(=O)=O)c3)ccc2C)cc1 |
| InChI | InChI=1S/C21H20FN3O6S2/c1-13-3-4-14(21(26)24-17-10-15(22)11-19(12-17)32(23,27)28)9-20(13)33(29,30)25-16-5-7-18(31-2)8-6-16/h3-12,25H,1-2H3,(H,24,26)(H2,23,27,28) |
| InChIKey | XTYQCKKYYLABIR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |