C20H30N4O3 — CID 55979927
4-[(carbamoylamino)methyl]-N-[1-(diethylcarbamoyl)cyclohexyl]benzamide (PubChem CID 55979927) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-[1-(diethylcarbamoyl)cyclohexyl]benzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-[1-(diethylcarbamoyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 55979927 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-[1-(diethylcarbamoyl)cyclohexyl]benzamide |
| SMILES | CCN(CC)C(=O)C1(NC(=O)c2ccc(CNC(N)=O)cc2)CCCCC1 |
| InChI | InChI=1S/C20H30N4O3/c1-3-24(4-2)18(26)20(12-6-5-7-13-20)23-17(25)16-10-8-15(9-11-16)14-22-19(21)27/h8-11H,3-7,12-14H2,1-2H3,(H,23,25)(H3,21,22,27) |
| InChIKey | CHEYRPVOGWHGNB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |