C24H28ClN3O3 — CID 55983063
1-benzyl-3-[1-[2-(4-chlorophenyl)morpholine-4-carbonyl]cyclopentyl]urea (PubChem CID 55983063) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-benzyl-3-[1-[2-(4-chlorophenyl)morpholine-4-carbonyl]cyclopentyl]urea.
| Compound Name | 1-benzyl-3-[1-[2-(4-chlorophenyl)morpholine-4-carbonyl]cyclopentyl]urea |
|---|---|
| PubChem CID | 55983063 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-benzyl-3-[1-[2-(4-chlorophenyl)morpholine-4-carbonyl]cyclopentyl]urea |
| SMILES | O=C(NCc1ccccc1)NC1(C(=O)N2CCOC(c3ccc(Cl)cc3)C2)CCCC1 |
| InChI | InChI=1S/C24H28ClN3O3/c25-20-10-8-19(9-11-20)21-17-28(14-15-31-21)22(29)24(12-4-5-13-24)27-23(30)26-16-18-6-2-1-3-7-18/h1-3,6-11,21H,4-5,12-17H2,(H2,26,27,30) |
| InChIKey | YMYXIOHAVMKYBO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |