C21H28BrN3O2S — CID 55984089
N-[4-[3-bromo-N-[2-(diethylamino)ethyl]anilino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 55984089) has the molecular formula C21H28BrN3O2S and a molecular weight of 466.45 g/mol. Its IUPAC name is N-[4-[3-bromo-N-[2-(diethylamino)ethyl]anilino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[3-bromo-N-[2-(diethylamino)ethyl]anilino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55984089 |
| Molecular Formula | C21H28BrN3O2S |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[4-[3-bromo-N-[2-(diethylamino)ethyl]anilino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | CCN(CC)CCN(C(=O)CCCNC(=O)c1cccs1)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H28BrN3O2S/c1-3-24(4-2)13-14-25(18-9-5-8-17(22)16-18)20(26)11-6-12-23-21(27)19-10-7-15-28-19/h5,7-10,15-16H,3-4,6,11-14H2,1-2H3,(H,23,27) |
| InChIKey | PFQNFDOMWLEUQK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|