C22H28BrN3O2 — CID 55985619
4-(acetamidomethyl)-N-(3-bromophenyl)-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 55985619) has the molecular formula C22H28BrN3O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is 4-(acetamidomethyl)-N-(3-bromophenyl)-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-(acetamidomethyl)-N-(3-bromophenyl)-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 55985619 |
| Molecular Formula | C22H28BrN3O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 4-(acetamidomethyl)-N-(3-bromophenyl)-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H28BrN3O2/c1-4-25(5-2)13-14-26(21-8-6-7-20(23)15-21)22(28)19-11-9-18(10-12-19)16-24-17(3)27/h6-12,15H,4-5,13-14,16H2,1-3H3,(H,24,27) |
| InChIKey | BBZDSBGLYFBYKX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |