C22H25BrN4O2 — CID 55984984
N-(3-bromophenyl)-N-[2-(diethylamino)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 55984984) has the molecular formula C22H25BrN4O2 and a molecular weight of 457.37 g/mol. Its IUPAC name is N-(3-bromophenyl)-N-[2-(diethylamino)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-(3-bromophenyl)-N-[2-(diethylamino)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55984984 |
| Molecular Formula | C22H25BrN4O2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-(3-bromophenyl)-N-[2-(diethylamino)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCN(CC)CCN(C(=O)c1nn(C)c(=O)c2ccccc12)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H25BrN4O2/c1-4-26(5-2)13-14-27(17-10-8-9-16(23)15-17)22(29)20-18-11-6-7-12-19(18)21(28)25(3)24-20/h6-12,15H,4-5,13-14H2,1-3H3 |
| InChIKey | VDIIBCZKZHTPAQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |