C19H23Cl2N3O3S — CID 55986294
[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-(1-prop-2-ynylpiperidin-4-yl)methanone (PubChem CID 55986294) has the molecular formula C19H23Cl2N3O3S and a molecular weight of 444.38 g/mol. Its IUPAC name is [4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-(1-prop-2-ynylpiperidin-4-yl)methanone.
| Compound Name | [4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-(1-prop-2-ynylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 55986294 |
| Molecular Formula | C19H23Cl2N3O3S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | [4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-(1-prop-2-ynylpiperidin-4-yl)methanone |
| SMILES | C#CCN1CCC(C(=O)N2CCN(S(=O)(=O)c3cccc(Cl)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C19H23Cl2N3O3S/c1-2-8-22-9-6-15(7-10-22)19(25)23-11-13-24(14-12-23)28(26,27)17-5-3-4-16(20)18(17)21/h1,3-5,15H,6-14H2 |
| InChIKey | GWMKMHKTKGZUHN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|